About N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide
N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide (PubChem CID 2326483) has the molecular formula C7H11N2OS+
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide |
| PubChem CID | 2326483 |
| Molecular Formula | C7H11N2OS+ |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide |
| SMILES | CC(=O)Nc1scc(C)[n+]1C |
| InChI | InChI=1S/C7H10N2OS/c1-5-4-11-7(9(5)3)8-6(2)10/h4H,1-3H3/p+1 |
| InChIKey | RUKRTDIRMBFTLT-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide?
The IUPAC name of N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide (CID 2326483) is N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide.
What is the SMILES notation for N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide?
The canonical SMILES for N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide is CC(=O)Nc1scc(C)[n+]1C.
What is the InChIKey of N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide?
The InChIKey is RUKRTDIRMBFTLT-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H10N2OS/c1-5-4-11-7(9(5)3)8-6(2)10/h4H,1-3H3/p+1.
What are the key properties of N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide?
N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide has a molecular weight of 171.24 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)acetamide is sourced from PubChem (CID 2326483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).