C13H14O8 — CID 23264924
[(1R,2R,6R,8R)-9-acetyloxy-3,11-dioxo-4,10-dioxatricyclo[6.3.0.02,6]undecan-5-yl] acetate (PubChem CID 23264924) has the molecular formula C13H14O8 and a molecular weight of 298.25 g/mol. Its IUPAC name is [(1R,2R,6R,8R)-9-acetyloxy-3,11-dioxo-4,10-dioxatricyclo[6.3.0.02,6]undecan-5-yl] acetate.
| Compound Name | [(1R,2R,6R,8R)-9-acetyloxy-3,11-dioxo-4,10-dioxatricyclo[6.3.0.02,6]undecan-5-yl] acetate |
|---|---|
| PubChem CID | 23264924 |
| Molecular Formula | C13H14O8 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [(1R,2R,6R,8R)-9-acetyloxy-3,11-dioxo-4,10-dioxatricyclo[6.3.0.02,6]undecan-5-yl] acetate |
| SMILES | CC(=O)OC1OC(=O)[C@H]2[C@@H]3C(=O)OC(OC(C)=O)[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C13H14O8/c1-4(14)18-12-6-3-7-9(8(6)10(16)20-12)11(17)21-13(7)19-5(2)15/h6-9,12-13H,3H2,1-2H3/t6-,7-,8-,9-,12?,13?/m1/s1 |
| InChIKey | RRCGWNCQBDWMNS-PLFLWAQMSA-N |
| XLogP | -0.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |