C14H6F9N2- — CID 23265232
[4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)azanide (PubChem CID 23265232) has the molecular formula C14H6F9N2- and a molecular weight of 373.20 g/mol. Its IUPAC name is [4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)azanide.
| Compound Name | [4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)azanide |
|---|---|
| PubChem CID | 23265232 |
| Molecular Formula | C14H6F9N2- |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | [4-(dimethylamino)-2,3,5,6-tetrafluorophenyl]-(2,3,4,5,6-pentafluorophenyl)azanide |
| SMILES | CN(C)c1c(F)c(F)c([N-]c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H6F9N2/c1-25(2)14-10(22)8(20)13(9(21)11(14)23)24-12-6(18)4(16)3(15)5(17)7(12)19/h1-2H3/q-1 |
| InChIKey | PYSABQKGEPIUFO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|