C14H7F9N2 — CID 23265233
2,3,5,6-tetrafluoro-4-N,4-N-dimethyl-1-N-(2,3,4,5,6-pentafluorophenyl)benzene-1,4-diamine (PubChem CID 23265233) has the molecular formula C14H7F9N2 and a molecular weight of 374.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-N,4-N-dimethyl-1-N-(2,3,4,5,6-pentafluorophenyl)benzene-1,4-diamine.
| Compound Name | 2,3,5,6-tetrafluoro-4-N,4-N-dimethyl-1-N-(2,3,4,5,6-pentafluorophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 23265233 |
| Molecular Formula | C14H7F9N2 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-N,4-N-dimethyl-1-N-(2,3,4,5,6-pentafluorophenyl)benzene-1,4-diamine |
| SMILES | CN(C)c1c(F)c(F)c(Nc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H7F9N2/c1-25(2)14-10(22)8(20)13(9(21)11(14)23)24-12-6(18)4(16)3(15)5(17)7(12)19/h24H,1-2H3 |
| InChIKey | BCVABRYFVCTUAK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|