C14H14N2O2S — CID 2326533
2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carbaldehyde (PubChem CID 2326533) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 2326533 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-morpholin-4-yl-4-phenyl-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(N2CCOCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2S/c17-10-12-13(11-4-2-1-3-5-11)15-14(19-12)16-6-8-18-9-7-16/h1-5,10H,6-9H2 |
| InChIKey | OFUUYKAZFQDERO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|