C16H24O2Si — CID 23265361
methyl (1R,2R,3S,4R,5S)-2-cyclopropyl-4-trimethylsilyltricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate (PubChem CID 23265361) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is methyl (1R,2R,3S,4R,5S)-2-cyclopropyl-4-trimethylsilyltricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate.
| Compound Name | methyl (1R,2R,3S,4R,5S)-2-cyclopropyl-4-trimethylsilyltricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate |
|---|---|
| PubChem CID | 23265361 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl (1R,2R,3S,4R,5S)-2-cyclopropyl-4-trimethylsilyltricyclo[3.2.1.02,4]oct-6-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@]2(C3CC3)[C@H]3C=C[C@H](C3)[C@@]12[Si](C)(C)C |
| InChI | InChI=1S/C16H24O2Si/c1-18-14(17)13-15(10-5-6-10)11-7-8-12(9-11)16(13,15)19(2,3)4/h7-8,10-13H,5-6,9H2,1-4H3/t11-,12+,13+,15+,16+/m0/s1 |
| InChIKey | QVRVPYJZQOUHPE-YAYDYNKSSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|