About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate (PubChem CID 23265513) has the molecular formula C19H32NO7P
and a molecular weight of 417.44 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate |
| PubChem CID | 23265513 |
| Molecular Formula | C19H32NO7P |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate |
| SMILES | CC1(C)OCC(COP(=O)([O-])OCC(C[N+](C)(C)C)OCc2ccccc2)O1 |
| InChI | InChI=1S/C19H32NO7P/c1-19(2)24-13-18(27-19)15-26-28(21,22)25-14-17(11-20(3,4)5)23-12-16-9-7-6-8-10-16/h6-10,17-18H,11-15H2,1-5H3 |
| InChIKey | ZJVCCHVAYQXAKM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate (CID 23265513) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate is CC1(C)OCC(COP(=O)([O-])OCC(C[N+](C)(C)C)OCc2ccccc2)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate?
The InChIKey is ZJVCCHVAYQXAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32NO7P/c1-19(2)24-13-18(27-19)15-26-28(21,22)25-14-17(11-20(3,4)5)23-12-16-9-7-6-8-10-16/h6-10,17-18H,11-15H2,1-5H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate has a molecular weight of 417.44 g/mol, XLogP of 1.93, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl [2-phenylmethoxy-3-(trimethylazaniumyl)propyl] phosphate is sourced from PubChem (CID 23265513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).