C19H33NO7P+ — CID 23265514
[3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy-hydroxyphosphoryl]oxy-2-phenylmethoxypropyl]-trimethylazanium (PubChem CID 23265514) has the molecular formula C19H33NO7P+ and a molecular weight of 418.45 g/mol. Its IUPAC name is [3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy-hydroxyphosphoryl]oxy-2-phenylmethoxypropyl]-trimethylazanium.
| Compound Name | [3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy-hydroxyphosphoryl]oxy-2-phenylmethoxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 23265514 |
| Molecular Formula | C19H33NO7P+ |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy-hydroxyphosphoryl]oxy-2-phenylmethoxypropyl]-trimethylazanium |
| SMILES | CC1(C)OCC(COP(=O)(O)OCC(C[N+](C)(C)C)OCc2ccccc2)O1 |
| InChI | InChI=1S/C19H32NO7P/c1-19(2)24-13-18(27-19)15-26-28(21,22)25-14-17(11-20(3,4)5)23-12-16-9-7-6-8-10-16/h6-10,17-18H,11-15H2,1-5H3/p+1 |
| InChIKey | ZJVCCHVAYQXAKM-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|