C18H20O2Si — CID 23266015
(1S,2S,11S,12R)-13-trimethylsilyltetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione (PubChem CID 23266015) has the molecular formula C18H20O2Si and a molecular weight of 296.44 g/mol. Its IUPAC name is (1S,2S,11S,12R)-13-trimethylsilyltetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione.
| Compound Name | (1S,2S,11S,12R)-13-trimethylsilyltetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
|---|---|
| PubChem CID | 23266015 |
| Molecular Formula | C18H20O2Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1S,2S,11S,12R)-13-trimethylsilyltetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
| SMILES | C[Si](C)(C)C1=C[C@H]2C[C@@H]1[C@H]1C(=O)c3ccccc3C(=O)[C@H]12 |
| InChI | InChI=1S/C18H20O2Si/c1-21(2,3)14-9-10-8-13(14)16-15(10)17(19)11-6-4-5-7-12(11)18(16)20/h4-7,9-10,13,15-16H,8H2,1-3H3/t10-,13+,15+,16-/m1/s1 |
| InChIKey | QMTSVWNNPQFGOW-UHDJJACNSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|