C22H38O3 — CID 23266102
(3E,8E,12E)-15,15-dimethoxy-8,12-dimethyl-5-propan-2-ylpentadeca-3,8,12-trien-2-one (PubChem CID 23266102) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (3E,8E,12E)-15,15-dimethoxy-8,12-dimethyl-5-propan-2-ylpentadeca-3,8,12-trien-2-one.
| Compound Name | (3E,8E,12E)-15,15-dimethoxy-8,12-dimethyl-5-propan-2-ylpentadeca-3,8,12-trien-2-one |
|---|---|
| PubChem CID | 23266102 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (3E,8E,12E)-15,15-dimethoxy-8,12-dimethyl-5-propan-2-ylpentadeca-3,8,12-trien-2-one |
| SMILES | COC(C/C=C(\C)CC/C=C(\C)CCC(/C=C/C(C)=O)C(C)C)OC |
| InChI | InChI=1S/C22H38O3/c1-17(2)21(15-13-20(5)23)14-11-18(3)9-8-10-19(4)12-16-22(24-6)25-7/h9,12-13,15,17,21-22H,8,10-11,14,16H2,1-7H3/b15-13+,18-9+,19-12+ |
| InChIKey | MMADLRBZCFNPFT-AMMZXCDVSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|