C6H4F8O — CID 23266237
4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanal (PubChem CID 23266237) has the molecular formula C6H4F8O and a molecular weight of 244.08 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanal.
| Compound Name | 4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanal |
|---|---|
| PubChem CID | 23266237 |
| Molecular Formula | C6H4F8O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanal |
| SMILES | O=CC(CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F8O/c7-4(8,6(12,13)14)1-3(2-15)5(9,10)11/h2-3H,1H2 |
| InChIKey | VRLFPHXVDQOSRC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|