C10H19NS — CID 23266418
(3aS,7aS)-2,2,3-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 23266418) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (3aS,7aS)-2,2,3-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | (3aS,7aS)-2,2,3-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 23266418 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (3aS,7aS)-2,2,3-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | CN1[C@H]2CCCC[C@@H]2SC1(C)C |
| InChI | InChI=1S/C10H19NS/c1-10(2)11(3)8-6-4-5-7-9(8)12-10/h8-9H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | UXADSLSTNRLOEJ-IUCAKERBSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |