C14H9BrF4HgO2 — CID 23266513
[(1S,8R,9S,10R)-10-acetyloxy-3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraenyl]-bromomercury (PubChem CID 23266513) has the molecular formula C14H9BrF4HgO2 and a molecular weight of 565.71 g/mol. Its IUPAC name is [(1S,8R,9S,10R)-10-acetyloxy-3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraenyl]-bromomercury.
| Compound Name | [(1S,8R,9S,10R)-10-acetyloxy-3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraenyl]-bromomercury |
|---|---|
| PubChem CID | 23266513 |
| Molecular Formula | C14H9BrF4HgO2 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | [(1S,8R,9S,10R)-10-acetyloxy-3,4,5,6-tetrafluoro-9-tricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraenyl]-bromomercury |
| SMILES | CC(=O)O[C@H]1[C@@H]([Hg]Br)[C@@H]2C=C[C@H]1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C14H9F4O2.BrH.Hg/c1-5(19)20-8-4-6-2-3-7(8)10-9(6)11(15)13(17)14(18)12(10)16;;/h2-4,6-8H,1H3;1H;/q;;+1/p-1/t6-,7+,8-;;/m0../s1 |
| InChIKey | ABNBAPPOVYBUIY-SGQZNDNTSA-M |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|