About 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine
4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine (PubChem CID 23266794) has the molecular formula C9H16N3O6P
and a molecular weight of 293.22 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine |
| PubChem CID | 23266794 |
| Molecular Formula | C9H16N3O6P |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine |
| SMILES | CCOP(=O)(OCC)C1N=C(OC)NC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N3O6P/c1-4-17-19(15,18-5-2)8-7(12(13)14)6-10-9(11-8)16-3/h6,8H,4-5H2,1-3H3,(H,10,11) |
| InChIKey | AHIQTHKFPUOMBR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine?
The IUPAC name of 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine (CID 23266794) is 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine.
What is the SMILES notation for 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine?
The canonical SMILES for 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine is CCOP(=O)(OCC)C1N=C(OC)NC=C1[N+](=O)[O-].
What is the InChIKey of 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine?
The InChIKey is AHIQTHKFPUOMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N3O6P/c1-4-17-19(15,18-5-2)8-7(12(13)14)6-10-9(11-8)16-3/h6,8H,4-5H2,1-3H3,(H,10,11).
What are the key properties of 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine?
4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine has a molecular weight of 293.22 g/mol, XLogP of 1.30, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diethoxyphosphoryl-2-methoxy-5-nitro-1,4-dihydropyrimidine is sourced from PubChem (CID 23266794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).