C17H13N3O5 — CID 23267425
2-[5-(4-methoxyphenyl)-4-nitro-4,5-dihydro-1,2-oxazol-3-yl]-1,3-benzoxazole (PubChem CID 23267425) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[5-(4-methoxyphenyl)-4-nitro-4,5-dihydro-1,2-oxazol-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[5-(4-methoxyphenyl)-4-nitro-4,5-dihydro-1,2-oxazol-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 23267425 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[5-(4-methoxyphenyl)-4-nitro-4,5-dihydro-1,2-oxazol-3-yl]-1,3-benzoxazole |
| SMILES | COc1ccc(C2ON=C(c3nc4ccccc4o3)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N3O5/c1-23-11-8-6-10(7-9-11)16-15(20(21)22)14(19-25-16)17-18-12-4-2-3-5-13(12)24-17/h2-9,15-16H,1H3 |
| InChIKey | WILVVQYSSVILIQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|