C18H32O8 — CID 23267723
(6Z,16Z)-10,20-dimethoxy-1,2,11,12-tetraoxacycloicosa-6,16-diene-3,13-diol (PubChem CID 23267723) has the molecular formula C18H32O8 and a molecular weight of 376.45 g/mol. Its IUPAC name is (6Z,16Z)-10,20-dimethoxy-1,2,11,12-tetraoxacycloicosa-6,16-diene-3,13-diol.
| Compound Name | (6Z,16Z)-10,20-dimethoxy-1,2,11,12-tetraoxacycloicosa-6,16-diene-3,13-diol |
|---|---|
| PubChem CID | 23267723 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (6Z,16Z)-10,20-dimethoxy-1,2,11,12-tetraoxacycloicosa-6,16-diene-3,13-diol |
| SMILES | COC1CC/C=C\CCC(O)OOC(OC)CC/C=C\CCC(O)OO1 |
| InChI | InChI=1S/C18H32O8/c1-21-17-13-9-5-3-7-12-16(20)24-26-18(22-2)14-10-6-4-8-11-15(19)23-25-17/h3-6,15-20H,7-14H2,1-2H3/b5-3-,6-4- |
| InChIKey | QPUWGTZKXMDLAN-GLIMQPGKSA-N |
| XLogP | 2.71 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|