C10H18O7S2-2 — CID 23268136
1-hydroxy-3,7-dimethyloct-6-ene-1,3-disulfonate (PubChem CID 23268136) has the molecular formula C10H18O7S2-2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-hydroxy-3,7-dimethyloct-6-ene-1,3-disulfonate.
| Compound Name | 1-hydroxy-3,7-dimethyloct-6-ene-1,3-disulfonate |
|---|---|
| PubChem CID | 23268136 |
| Molecular Formula | C10H18O7S2-2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-hydroxy-3,7-dimethyloct-6-ene-1,3-disulfonate |
| SMILES | CC(C)=CCCC(C)(CC(O)S(=O)(=O)[O-])S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H20O7S2/c1-8(2)5-4-6-10(3,19(15,16)17)7-9(11)18(12,13)14/h5,9,11H,4,6-7H2,1-3H3,(H,12,13,14)(H,15,16,17)/p-2 |
| InChIKey | YUULZOUPGRQASS-UHFFFAOYSA-L |
| XLogP | 0.29 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|