About (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene
(Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene (PubChem CID 23268151) has the molecular formula C10H21O5P
and a molecular weight of 252.25 g/mol. Its IUPAC name is (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene.
Molecular Properties
| Compound Name | (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene |
| PubChem CID | 23268151 |
| Molecular Formula | C10H21O5P |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene |
| SMILES | CCOP(=O)(OCC)/C(COC)=C(/C)OC |
| InChI | InChI=1S/C10H21O5P/c1-6-14-16(11,15-7-2)10(8-12-4)9(3)13-5/h6-8H2,1-5H3/b10-9- |
| InChIKey | GIJOVDICGQGWPC-KTKRTIGZSA-N |
| XLogP | 2.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene?
The IUPAC name of (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene (CID 23268151) is (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene.
What is the SMILES notation for (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene?
The canonical SMILES for (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene is CCOP(=O)(OCC)/C(COC)=C(/C)OC.
What is the InChIKey of (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene?
The InChIKey is GIJOVDICGQGWPC-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H21O5P/c1-6-14-16(11,15-7-2)10(8-12-4)9(3)13-5/h6-8H2,1-5H3/b10-9-.
What are the key properties of (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene?
(Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene has a molecular weight of 252.25 g/mol, XLogP of 2.78, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-diethoxyphosphoryl-1,3-dimethoxybut-2-ene is sourced from PubChem (CID 23268151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).