C11H9F5O2S — CID 23268160
[2-methylsulfanyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl] acetate (PubChem CID 23268160) has the molecular formula C11H9F5O2S and a molecular weight of 300.25 g/mol. Its IUPAC name is [2-methylsulfanyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl] acetate.
| Compound Name | [2-methylsulfanyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl] acetate |
|---|---|
| PubChem CID | 23268160 |
| Molecular Formula | C11H9F5O2S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | [2-methylsulfanyl-1-(2,3,4,5,6-pentafluorophenyl)ethyl] acetate |
| SMILES | CSCC(OC(C)=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5O2S/c1-4(17)18-5(3-19-2)6-7(12)9(14)11(16)10(15)8(6)13/h5H,3H2,1-2H3 |
| InChIKey | QJBVOVRGQBJOOL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|