C13H13F3 — CID 23268393
2-(3-methylbut-1-ynyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 23268393) has the molecular formula C13H13F3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-(3-methylbut-1-ynyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-(3-methylbut-1-ynyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 23268393 |
| Molecular Formula | C13H13F3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(3-methylbut-1-ynyl)-3-(trifluoromethyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C)C#CC1=C(C(F)(F)F)C2C=CC1C2 |
| InChI | InChI=1S/C13H13F3/c1-8(2)3-6-11-9-4-5-10(7-9)12(11)13(14,15)16/h4-5,8-10H,7H2,1-2H3 |
| InChIKey | RKLGAOAPVXNXHY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|