About 2,2-difluoro-N'-methylacetohydrazide
2,2-difluoro-N'-methylacetohydrazide (PubChem CID 23268500) has the molecular formula C3H6F2N2O
and a molecular weight of 124.09 g/mol. Its IUPAC name is 2,2-difluoro-N'-methylacetohydrazide.
Molecular Properties
| Compound Name | 2,2-difluoro-N'-methylacetohydrazide |
| PubChem CID | 23268500 |
| Molecular Formula | C3H6F2N2O |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.04 |
| IUPAC Name | 2,2-difluoro-N'-methylacetohydrazide |
| SMILES | CNNC(=O)C(F)F |
| InChI | InChI=1S/C3H6F2N2O/c1-6-7-3(8)2(4)5/h2,6H,1H3,(H,7,8) |
| InChIKey | RTDHFQUMGQANPV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-N'-methylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N'-methylacetohydrazide?
The IUPAC name of 2,2-difluoro-N'-methylacetohydrazide (CID 23268500) is 2,2-difluoro-N'-methylacetohydrazide.
What is the SMILES notation for 2,2-difluoro-N'-methylacetohydrazide?
The canonical SMILES for 2,2-difluoro-N'-methylacetohydrazide is CNNC(=O)C(F)F.
What is the InChIKey of 2,2-difluoro-N'-methylacetohydrazide?
The InChIKey is RTDHFQUMGQANPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F2N2O/c1-6-7-3(8)2(4)5/h2,6H,1H3,(H,7,8).
What are the key properties of 2,2-difluoro-N'-methylacetohydrazide?
2,2-difluoro-N'-methylacetohydrazide has a molecular weight of 124.09 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N'-methylacetohydrazide is sourced from PubChem (CID 23268500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).