C29H24BrN3S — CID 2326862
N-[6-(4-bromophenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]benzenecarbothioamide (PubChem CID 2326862) has the molecular formula C29H24BrN3S and a molecular weight of 526.50 g/mol. Its IUPAC name is N-[6-(4-bromophenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]benzenecarbothioamide.
| Compound Name | N-[6-(4-bromophenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 2326862 |
| Molecular Formula | C29H24BrN3S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | N-[6-(4-bromophenyl)-2-phenyl-1,4-diazatricyclo[5.4.1.04,12]dodeca-2,5,7(12)-trien-5-yl]benzenecarbothioamide |
| SMILES | S=C(Nc1c(-c2ccc(Br)cc2)c2c3n(c(-c4ccccc4)cn13)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C29H24BrN3S/c30-23-16-14-21(15-17-23)26-24-13-7-8-18-32-25(20-9-3-1-4-10-20)19-33(29(24)32)27(26)31-28(34)22-11-5-2-6-12-22/h1-6,9-12,14-17,19H,7-8,13,18H2,(H,31,34) |
| InChIKey | ZQMWILMOUUKIEM-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 21.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|