About trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane
trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane (PubChem CID 23268630) has the molecular formula C7H15O3P
and a molecular weight of 178.17 g/mol. Its IUPAC name is trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane.
Molecular Properties
| Compound Name | trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane |
| PubChem CID | 23268630 |
| Molecular Formula | C7H15O3P |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane |
| SMILES | COP(=O)(OC)[C@@]1(C)C[C@H]1C |
| InChI | InChI=1S/C7H15O3P/c1-6-5-7(6,2)11(8,9-3)10-4/h6H,5H2,1-4H3/t6-,7+/m1/s1 |
| InChIKey | RVHWSNVUMGHVOS-RQJHMYQMSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane?
The IUPAC name of trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane (CID 23268630) is trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane.
What is the SMILES notation for trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane?
The canonical SMILES for trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane is COP(=O)(OC)[C@@]1(C)C[C@H]1C.
What is the InChIKey of trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane?
The InChIKey is RVHWSNVUMGHVOS-RQJHMYQMSA-N. The full InChI is InChI=1S/C7H15O3P/c1-6-5-7(6,2)11(8,9-3)10-4/h6H,5H2,1-4H3/t6-,7+/m1/s1.
What are the key properties of trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane?
trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane has a molecular weight of 178.17 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1-dimethoxyphosphoryl-1,2-dimethylcyclopropane is sourced from PubChem (CID 23268630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).