C8H13ClO — CID 23268670
(1S,3S,4S,6R)-4-chloro-3-methylbicyclo[4.1.0]heptan-3-ol (PubChem CID 23268670) has the molecular formula C8H13ClO and a molecular weight of 160.64 g/mol. Its IUPAC name is (1S,3S,4S,6R)-4-chloro-3-methylbicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1S,3S,4S,6R)-4-chloro-3-methylbicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 23268670 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (1S,3S,4S,6R)-4-chloro-3-methylbicyclo[4.1.0]heptan-3-ol |
| SMILES | C[C@]1(O)C[C@@H]2C[C@@H]2C[C@@H]1Cl |
| InChI | InChI=1S/C8H13ClO/c1-8(10)4-6-2-5(6)3-7(8)9/h5-7,10H,2-4H2,1H3/t5-,6+,7+,8+/m1/s1 |
| InChIKey | PLEAUSYZWKARTO-KVPKETBZSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|