C5H15NSi2 — CID 23268921
1,1,2,3,3-pentamethyldisilazane (PubChem CID 23268921) has the molecular formula C5H15NSi2 and a molecular weight of 145.35 g/mol.
| Compound Name | 1,1,2,3,3-pentamethyldisilazane |
|---|---|
| PubChem CID | 23268921 |
| Molecular Formula | C5H15NSi2 |
| Molecular Weight | 145.35 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | — |
| SMILES | CN([Si](C)C)[Si](C)C |
| InChI | InChI=1S/C5H15NSi2/c1-6(7(2)3)8(4)5/h1-5H3 |
| InChIKey | LASFAPCNRMLDEB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|