C6H7Br5S — CID 23268941
2,3,3,4,4-pentabromo-1-ethylsulfanylbut-1-ene (PubChem CID 23268941) has the molecular formula C6H7Br5S and a molecular weight of 510.71 g/mol. Its IUPAC name is 2,3,3,4,4-pentabromo-1-ethylsulfanylbut-1-ene.
| Compound Name | 2,3,3,4,4-pentabromo-1-ethylsulfanylbut-1-ene |
|---|---|
| PubChem CID | 23268941 |
| Molecular Formula | C6H7Br5S |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 505.62 |
| IUPAC Name | 2,3,3,4,4-pentabromo-1-ethylsulfanylbut-1-ene |
| SMILES | CCSC=C(Br)C(Br)(Br)C(Br)Br |
| InChI | InChI=1S/C6H7Br5S/c1-2-12-3-4(7)6(10,11)5(8)9/h3,5H,2H2,1H3 |
| InChIKey | TTWMTHNJOCMXTB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|