About 2-(2-chloroethyl)-1,1-dimethylcyclopropane
2-(2-chloroethyl)-1,1-dimethylcyclopropane (PubChem CID 23269032) has the molecular formula C7H13Cl
and a molecular weight of 132.63 g/mol. Its IUPAC name is 2-(2-chloroethyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | 2-(2-chloroethyl)-1,1-dimethylcyclopropane |
| PubChem CID | 23269032 |
| Molecular Formula | C7H13Cl |
| Molecular Weight | 132.63 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-(2-chloroethyl)-1,1-dimethylcyclopropane |
| SMILES | CC1(C)CC1CCCl |
| InChI | InChI=1S/C7H13Cl/c1-7(2)5-6(7)3-4-8/h6H,3-5H2,1-2H3 |
| InChIKey | SXHNYNVUPJXSRN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethyl)-1,1-dimethylcyclopropane?
The IUPAC name of 2-(2-chloroethyl)-1,1-dimethylcyclopropane (CID 23269032) is 2-(2-chloroethyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for 2-(2-chloroethyl)-1,1-dimethylcyclopropane?
The canonical SMILES for 2-(2-chloroethyl)-1,1-dimethylcyclopropane is CC1(C)CC1CCCl.
What is the InChIKey of 2-(2-chloroethyl)-1,1-dimethylcyclopropane?
The InChIKey is SXHNYNVUPJXSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl/c1-7(2)5-6(7)3-4-8/h6H,3-5H2,1-2H3.
What are the key properties of 2-(2-chloroethyl)-1,1-dimethylcyclopropane?
2-(2-chloroethyl)-1,1-dimethylcyclopropane has a molecular weight of 132.63 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 23269032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).