About 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan
2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan (PubChem CID 23269100) has the molecular formula C8H15O4P
and a molecular weight of 206.18 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan.
Molecular Properties
| Compound Name | 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan |
| PubChem CID | 23269100 |
| Molecular Formula | C8H15O4P |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan |
| SMILES | COP(=O)(OC)C1(C)CC=C(C)O1 |
| InChI | InChI=1S/C8H15O4P/c1-7-5-6-8(2,12-7)13(9,10-3)11-4/h5H,6H2,1-4H3 |
| InChIKey | PDPZNQYYRMDDFQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan?
The IUPAC name of 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan (CID 23269100) is 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan.
What is the SMILES notation for 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan?
The canonical SMILES for 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan is COP(=O)(OC)C1(C)CC=C(C)O1.
What is the InChIKey of 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan?
The InChIKey is PDPZNQYYRMDDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O4P/c1-7-5-6-8(2,12-7)13(9,10-3)11-4/h5H,6H2,1-4H3.
What are the key properties of 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan?
2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan has a molecular weight of 206.18 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethoxyphosphoryl-2,5-dimethyl-3H-furan is sourced from PubChem (CID 23269100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).