C12H12F14O3 — CID 23269427
1-[1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-yloxy]-1,1,2,3,3,3-hexafluoropropane (PubChem CID 23269427) has the molecular formula C12H12F14O3 and a molecular weight of 470.20 g/mol. Its IUPAC name is 1-[1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-yloxy]-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | 1-[1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-yloxy]-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 23269427 |
| Molecular Formula | C12H12F14O3 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-[1,3-bis(2,2,3,3-tetrafluoropropoxy)propan-2-yloxy]-1,1,2,3,3,3-hexafluoropropane |
| SMILES | FC(F)C(F)(F)COCC(COCC(F)(F)C(F)F)OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F14O3/c13-6(11(22,23)24)12(25,26)29-5(1-27-3-9(18,19)7(14)15)2-28-4-10(20,21)8(16)17/h5-8H,1-4H2 |
| InChIKey | KPHNKKSAPRQYSQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|