About 1,4-dipentyltriazole
1,4-dipentyltriazole (PubChem CID 23269501) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 1,4-dipentyltriazole.
Molecular Properties
| Compound Name | 1,4-dipentyltriazole |
| PubChem CID | 23269501 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1,4-dipentyltriazole |
| SMILES | CCCCCc1cn(CCCCC)nn1 |
| InChI | InChI=1S/C12H23N3/c1-3-5-7-9-12-11-15(14-13-12)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | ISHLBQJTPGLVTD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dipentyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dipentyltriazole?
The IUPAC name of 1,4-dipentyltriazole (CID 23269501) is 1,4-dipentyltriazole.
What is the SMILES notation for 1,4-dipentyltriazole?
The canonical SMILES for 1,4-dipentyltriazole is CCCCCc1cn(CCCCC)nn1.
What is the InChIKey of 1,4-dipentyltriazole?
The InChIKey is ISHLBQJTPGLVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-3-5-7-9-12-11-15(14-13-12)10-8-6-4-2/h11H,3-10H2,1-2H3.
What are the key properties of 1,4-dipentyltriazole?
1,4-dipentyltriazole has a molecular weight of 209.34 g/mol, XLogP of 3.20, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dipentyltriazole is sourced from PubChem (CID 23269501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).