C13H15BrN3O+ — CID 23269774
1-(4-bromophenyl)-2-(1,3,5-trimethyl-1,2,4-triazol-4-ium-4-yl)ethanone (PubChem CID 23269774) has the molecular formula C13H15BrN3O+ and a molecular weight of 309.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(1,3,5-trimethyl-1,2,4-triazol-4-ium-4-yl)ethanone.
| Compound Name | 1-(4-bromophenyl)-2-(1,3,5-trimethyl-1,2,4-triazol-4-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 23269774 |
| Molecular Formula | C13H15BrN3O+ |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(4-bromophenyl)-2-(1,3,5-trimethyl-1,2,4-triazol-4-ium-4-yl)ethanone |
| SMILES | Cc1nn(C)c(C)[n+]1CC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H15BrN3O/c1-9-15-16(3)10(2)17(9)8-13(18)11-4-6-12(14)7-5-11/h4-7H,8H2,1-3H3/q+1 |
| InChIKey | QQQGPKFIRYRQPU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|