C14H25N3O2 — CID 23269854
N-cyclohexyl-1-(1-hydroxy-2,2,5,5-tetramethyl-3-oxidoimidazol-3-ium-4-yl)methanimine (PubChem CID 23269854) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is N-cyclohexyl-1-(1-hydroxy-2,2,5,5-tetramethyl-3-oxidoimidazol-3-ium-4-yl)methanimine.
| Compound Name | N-cyclohexyl-1-(1-hydroxy-2,2,5,5-tetramethyl-3-oxidoimidazol-3-ium-4-yl)methanimine |
|---|---|
| PubChem CID | 23269854 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | N-cyclohexyl-1-(1-hydroxy-2,2,5,5-tetramethyl-3-oxidoimidazol-3-ium-4-yl)methanimine |
| SMILES | CC1(C)C(/C=N/C2CCCCC2)=[N+]([O-])C(C)(C)N1O |
| InChI | InChI=1S/C14H25N3O2/c1-13(2)12(16(18)14(3,4)17(13)19)10-15-11-8-6-5-7-9-11/h10-11,19H,5-9H2,1-4H3/b15-10+ |
| InChIKey | MKBBSJRNHBIFSE-XNTDXEJSSA-N |
| XLogP | 2.56 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|