C16H3F9N2 — CID 23269905
2-[4-(cyanomethyl)-2,3,5,6-tetrafluorophenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile (PubChem CID 23269905) has the molecular formula C16H3F9N2 and a molecular weight of 394.20 g/mol. Its IUPAC name is 2-[4-(cyanomethyl)-2,3,5,6-tetrafluorophenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile.
| Compound Name | 2-[4-(cyanomethyl)-2,3,5,6-tetrafluorophenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 23269905 |
| Molecular Formula | C16H3F9N2 |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-[4-(cyanomethyl)-2,3,5,6-tetrafluorophenyl]-2-(2,3,4,5,6-pentafluorophenyl)acetonitrile |
| SMILES | N#CCc1c(F)c(F)c(C(C#N)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H3F9N2/c17-8-4(1-2-26)9(18)11(20)6(10(8)19)5(3-27)7-12(21)14(23)16(25)15(24)13(7)22/h5H,1H2 |
| InChIKey | FKSZILJPJNRIJN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|