C17H13PS — CID 23270081
penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 23270081) has the molecular formula C17H13PS and a molecular weight of 280.33 g/mol. Its IUPAC name is penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 23270081 |
| Molecular Formula | C17H13PS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CC#CC#CP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13PS/c1-2-3-10-15-18(19,16-11-6-4-7-12-16)17-13-8-5-9-14-17/h4-9,11-14H,1H3 |
| InChIKey | UBKZUQCDNLUULU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|