About penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane
penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 23270081) has the molecular formula C17H13PS
and a molecular weight of 280.33 g/mol. Its IUPAC name is penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 23270081 |
| Molecular Formula | C17H13PS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | CC#CC#CP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H13PS/c1-2-3-10-15-18(19,16-11-6-4-7-12-16)17-13-8-5-9-14-17/h4-9,11-14H,1H3 |
| InChIKey | UBKZUQCDNLUULU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane (CID 23270081) is penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane is CC#CC#CP(=S)(c1ccccc1)c1ccccc1.
What is the InChIKey of penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane?
The InChIKey is UBKZUQCDNLUULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13PS/c1-2-3-10-15-18(19,16-11-6-4-7-12-16)17-13-8-5-9-14-17/h4-9,11-14H,1H3.
What are the key properties of penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane?
penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane has a molecular weight of 280.33 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,3-diynyl-diphenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 23270081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).