About 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane
2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane (PubChem CID 23270102) has the molecular formula C9H17O3P
and a molecular weight of 204.21 g/mol. Its IUPAC name is 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane.
Molecular Properties
| Compound Name | 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane |
| PubChem CID | 23270102 |
| Molecular Formula | C9H17O3P |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane |
| SMILES | C=C=CP(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C9H17O3P/c1-6-7-13(10,11-8(2)3)12-9(4)5/h7-9H,1H2,2-5H3 |
| InChIKey | NNXXTOGFTHFAIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane?
The IUPAC name of 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane (CID 23270102) is 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane.
What is the SMILES notation for 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane?
The canonical SMILES for 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane is C=C=CP(=O)(OC(C)C)OC(C)C.
What is the InChIKey of 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane?
The InChIKey is NNXXTOGFTHFAIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O3P/c1-6-7-13(10,11-8(2)3)12-9(4)5/h7-9H,1H2,2-5H3.
What are the key properties of 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane?
2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane has a molecular weight of 204.21 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[propa-1,2-dienyl(propan-2-yloxy)phosphoryl]oxypropane is sourced from PubChem (CID 23270102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).