About buta-2,3-dien-2-ylsulfanylbenzene
buta-2,3-dien-2-ylsulfanylbenzene (PubChem CID 23270110) has the molecular formula C10H10S
and a molecular weight of 162.26 g/mol. Its IUPAC name is buta-2,3-dien-2-ylsulfanylbenzene.
Molecular Properties
| Compound Name | buta-2,3-dien-2-ylsulfanylbenzene |
| PubChem CID | 23270110 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | buta-2,3-dien-2-ylsulfanylbenzene |
| SMILES | C=C=C(C)Sc1ccccc1 |
| InChI | InChI=1S/C10H10S/c1-3-9(2)11-10-7-5-4-6-8-10/h4-8H,1H2,2H3 |
| InChIKey | ZIXGMGIILFXMMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze buta-2,3-dien-2-ylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-2,3-dien-2-ylsulfanylbenzene?
The IUPAC name of buta-2,3-dien-2-ylsulfanylbenzene (CID 23270110) is buta-2,3-dien-2-ylsulfanylbenzene.
What is the SMILES notation for buta-2,3-dien-2-ylsulfanylbenzene?
The canonical SMILES for buta-2,3-dien-2-ylsulfanylbenzene is C=C=C(C)Sc1ccccc1.
What is the InChIKey of buta-2,3-dien-2-ylsulfanylbenzene?
The InChIKey is ZIXGMGIILFXMMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10S/c1-3-9(2)11-10-7-5-4-6-8-10/h4-8H,1H2,2H3.
What are the key properties of buta-2,3-dien-2-ylsulfanylbenzene?
buta-2,3-dien-2-ylsulfanylbenzene has a molecular weight of 162.26 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-2,3-dien-2-ylsulfanylbenzene is sourced from PubChem (CID 23270110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).