About 4-cyanophenolate
4-cyanophenolate (PubChem CID 23270156) has the molecular formula C7H4NO-
and a molecular weight of 118.11 g/mol. Its IUPAC name is 4-cyanophenolate.
Molecular Properties
| Compound Name | 4-cyanophenolate |
| PubChem CID | 23270156 |
| Molecular Formula | C7H4NO- |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 4-cyanophenolate |
| SMILES | N#Cc1ccc([O-])cc1 |
| InChI | InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H/p-1 |
| InChIKey | CVNOWLNNPYYEOH-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 46.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyanophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanophenolate?
The IUPAC name of 4-cyanophenolate (CID 23270156) is 4-cyanophenolate.
What is the SMILES notation for 4-cyanophenolate?
The canonical SMILES for 4-cyanophenolate is N#Cc1ccc([O-])cc1.
What is the InChIKey of 4-cyanophenolate?
The InChIKey is CVNOWLNNPYYEOH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H/p-1.
What are the key properties of 4-cyanophenolate?
4-cyanophenolate has a molecular weight of 118.11 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanophenolate is sourced from PubChem (CID 23270156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).