About 2-bromo-4-nitrosophenol
2-bromo-4-nitrosophenol (PubChem CID 23270210) has the molecular formula C6H4BrNO2
and a molecular weight of 202.01 g/mol. Its IUPAC name is 2-bromo-4-nitrosophenol.
Molecular Properties
| Compound Name | 2-bromo-4-nitrosophenol |
| PubChem CID | 23270210 |
| Molecular Formula | C6H4BrNO2 |
| Molecular Weight | 202.01 g/mol |
| Exact Mass | 200.94 |
| IUPAC Name | 2-bromo-4-nitrosophenol |
| SMILES | O=Nc1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C6H4BrNO2/c7-5-3-4(8-10)1-2-6(5)9/h1-3,9H |
| InChIKey | LRLQKLHZZOVGSF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.01 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-nitrosophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-nitrosophenol?
The IUPAC name of 2-bromo-4-nitrosophenol (CID 23270210) is 2-bromo-4-nitrosophenol.
What is the SMILES notation for 2-bromo-4-nitrosophenol?
The canonical SMILES for 2-bromo-4-nitrosophenol is O=Nc1ccc(O)c(Br)c1.
What is the InChIKey of 2-bromo-4-nitrosophenol?
The InChIKey is LRLQKLHZZOVGSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO2/c7-5-3-4(8-10)1-2-6(5)9/h1-3,9H.
What are the key properties of 2-bromo-4-nitrosophenol?
2-bromo-4-nitrosophenol has a molecular weight of 202.01 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-nitrosophenol is sourced from PubChem (CID 23270210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).