C12H15NO3 — CID 23270233
[(Z)-(3-tert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate (PubChem CID 23270233) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is [(Z)-(3-tert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate.
| Compound Name | [(Z)-(3-tert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate |
|---|---|
| PubChem CID | 23270233 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [(Z)-(3-tert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate |
| SMILES | CC(=O)O/N=C1/C=CC(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C12H15NO3/c1-8(14)16-13-9-5-6-11(15)10(7-9)12(2,3)4/h5-7H,1-4H3/b13-9- |
| InChIKey | JTPJRBCPQKHALP-LCYFTJDESA-N |
| XLogP | 2.02 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|