About [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate
[(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate (PubChem CID 23270252) has the molecular formula C9H8ClNO3
and a molecular weight of 213.62 g/mol. Its IUPAC name is [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate.
Molecular Properties
| Compound Name | [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate |
| PubChem CID | 23270252 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate |
| SMILES | CC(=O)O/N=C1\C=C(Cl)C(=O)C=C1C |
| InChI | InChI=1S/C9H8ClNO3/c1-5-3-9(13)7(10)4-8(5)11-14-6(2)12/h3-4H,1-2H3/b11-8+ |
| InChIKey | UTYZQAHWMIIXLW-DHZHZOJOSA-N |
| XLogP | 1.56 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate?
The IUPAC name of [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate (CID 23270252) is [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate.
What is the SMILES notation for [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate?
The canonical SMILES for [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate is CC(=O)O/N=C1\C=C(Cl)C(=O)C=C1C.
What is the InChIKey of [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate?
The InChIKey is UTYZQAHWMIIXLW-DHZHZOJOSA-N. The full InChI is InChI=1S/C9H8ClNO3/c1-5-3-9(13)7(10)4-8(5)11-14-6(2)12/h3-4H,1-2H3/b11-8+.
What are the key properties of [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate?
[(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate has a molecular weight of 213.62 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(5-chloro-2-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] acetate is sourced from PubChem (CID 23270252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).