C11H10Cl2 — CID 23270308
(1S,8S,9R)-9,11-dichlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 23270308) has the molecular formula C11H10Cl2 and a molecular weight of 213.11 g/mol. Its IUPAC name is (1S,8S,9R)-9,11-dichlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1S,8S,9R)-9,11-dichlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 23270308 |
| Molecular Formula | C11H10Cl2 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (1S,8S,9R)-9,11-dichlorotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | ClC1[C@H]2c3ccccc3[C@@H]1C[C@H]2Cl |
| InChI | InChI=1S/C11H10Cl2/c12-9-5-8-6-3-1-2-4-7(6)10(9)11(8)13/h1-4,8-11H,5H2/t8-,9+,10-,11?/m0/s1 |
| InChIKey | FQHXTLXGPVKSPV-JDUUOCRZSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|