C15H16O5S — CID 23270317
[(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate (PubChem CID 23270317) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is [(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23270317 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H]3C[C@H]4[C@@H]2OC(=O)[C@H]4C3)cc1 |
| InChI | InChI=1S/C15H16O5S/c1-8-2-4-10(5-3-8)21(17,18)20-13-9-6-11-12(7-9)15(16)19-14(11)13/h2-5,9,11-14H,6-7H2,1H3/t9-,11+,12-,13-,14-/m0/s1 |
| InChIKey | LOLNOBBQLBFAFD-SWTDPAGASA-N |
| XLogP | 1.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|