C9H9ClHgO4 — CID 23270324
[(1S,2S,3S,6R,7R,9R)-9-carboxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]-chloromercury (PubChem CID 23270324) has the molecular formula C9H9ClHgO4 and a molecular weight of 417.21 g/mol. Its IUPAC name is [(1S,2S,3S,6R,7R,9R)-9-carboxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]-chloromercury.
| Compound Name | [(1S,2S,3S,6R,7R,9R)-9-carboxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]-chloromercury |
|---|---|
| PubChem CID | 23270324 |
| Molecular Formula | C9H9ClHgO4 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | [(1S,2S,3S,6R,7R,9R)-9-carboxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]-chloromercury |
| SMILES | O=C1O[C@H]2[C@@H]3C[C@H]([C@@H]2[Hg]Cl)[C@H](C(=O)O)[C@H]13 |
| InChI | InChI=1S/C9H9O4.ClH.Hg/c10-8(11)6-3-1-4-5(2-3)13-9(12)7(4)6;;/h2-7H,1H2,(H,10,11);1H;/q;;+1/p-1/t3-,4+,5-,6+,7-;;/m1../s1 |
| InChIKey | KWENFVUVSLXIPU-PZQLQOAWSA-M |
| XLogP | 0.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|