About 3-(bromomethyl)hepta-1,2-diene
3-(bromomethyl)hepta-1,2-diene (PubChem CID 23270419) has the molecular formula C8H13Br
and a molecular weight of 189.10 g/mol. Its IUPAC name is 3-(bromomethyl)hepta-1,2-diene.
Molecular Properties
| Compound Name | 3-(bromomethyl)hepta-1,2-diene |
| PubChem CID | 23270419 |
| Molecular Formula | C8H13Br |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 3-(bromomethyl)hepta-1,2-diene |
| SMILES | C=C=C(CBr)CCCC |
| InChI | InChI=1S/C8H13Br/c1-3-5-6-8(4-2)7-9/h2-3,5-7H2,1H3 |
| InChIKey | QYCHGNYUTQSKFQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)hepta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)hepta-1,2-diene?
The IUPAC name of 3-(bromomethyl)hepta-1,2-diene (CID 23270419) is 3-(bromomethyl)hepta-1,2-diene.
What is the SMILES notation for 3-(bromomethyl)hepta-1,2-diene?
The canonical SMILES for 3-(bromomethyl)hepta-1,2-diene is C=C=C(CBr)CCCC.
What is the InChIKey of 3-(bromomethyl)hepta-1,2-diene?
The InChIKey is QYCHGNYUTQSKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Br/c1-3-5-6-8(4-2)7-9/h2-3,5-7H2,1H3.
What are the key properties of 3-(bromomethyl)hepta-1,2-diene?
3-(bromomethyl)hepta-1,2-diene has a molecular weight of 189.10 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)hepta-1,2-diene is sourced from PubChem (CID 23270419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).