C15H12 — CID 23270805
(11R,13S)-11-deuteriopentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene (PubChem CID 23270805) has the molecular formula C15H12 and a molecular weight of 193.27 g/mol. Its IUPAC name is (11R,13S)-11-deuteriopentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene.
| Compound Name | (11R,13S)-11-deuteriopentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene |
|---|---|
| PubChem CID | 23270805 |
| Molecular Formula | C15H12 |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (11R,13S)-11-deuteriopentacyclo[7.5.1.05,15.010,14.011,13]pentadeca-1,3,5(15),6,8-pentaene |
| SMILES | [2H][C@@]12C[C@@H]1C1c3cccc4cccc(c34)C12 |
| InChI | InChI=1S/C15H12/c1-3-8-4-2-6-10-13(8)9(5-1)14-11-7-12(11)15(10)14/h1-6,11-12,14-15H,7H2/t11-,12+,14?,15?/i11D/m1/s1 |
| InChIKey | ZXXVDIJIIOVHID-IVADPUJLSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |