C10H21N2O2+ — CID 23270873
trimethyl-[[(1R,5R,7R)-5-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]methyl]azanium (PubChem CID 23270873) has the molecular formula C10H21N2O2+ and a molecular weight of 201.29 g/mol. Its IUPAC name is trimethyl-[[(1R,5R,7R)-5-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]methyl]azanium.
| Compound Name | trimethyl-[[(1R,5R,7R)-5-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]methyl]azanium |
|---|---|
| PubChem CID | 23270873 |
| Molecular Formula | C10H21N2O2+ |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | trimethyl-[[(1R,5R,7R)-5-methyl-6,8-dioxa-3-azabicyclo[3.2.1]octan-7-yl]methyl]azanium |
| SMILES | C[C@@]12CNC[C@@H](O1)[C@@H](C[N+](C)(C)C)O2 |
| InChI | InChI=1S/C10H21N2O2/c1-10-7-11-5-8(13-10)9(14-10)6-12(2,3)4/h8-9,11H,5-7H2,1-4H3/q+1/t8-,9-,10-/m1/s1 |
| InChIKey | NRCIKIKMYWEZOW-OPRDCNLKSA-N |
| XLogP | -0.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|