C8H7Cl3 — CID 23270983
(1S,2S,4S,5S)-1,6,7-trichlorotricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 23270983) has the molecular formula C8H7Cl3 and a molecular weight of 209.50 g/mol. Its IUPAC name is (1S,2S,4S,5S)-1,6,7-trichlorotricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1S,2S,4S,5S)-1,6,7-trichlorotricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 23270983 |
| Molecular Formula | C8H7Cl3 |
| Molecular Weight | 209.50 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | (1S,2S,4S,5S)-1,6,7-trichlorotricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)C[C@H]1[C@@H]1C[C@@H]12 |
| InChI | InChI=1S/C8H7Cl3/c9-6-4-2-8(11,7(6)10)5-1-3(4)5/h3-5H,1-2H2/t3-,4-,5-,8-/m0/s1 |
| InChIKey | HVGAOBCQMLSXQT-RGDLXGNYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|