C8H6Cl4 — CID 23270986
(1R,2S,4R,5R)-1,6,7,8-tetrachlorotricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 23270986) has the molecular formula C8H6Cl4 and a molecular weight of 243.95 g/mol. Its IUPAC name is (1R,2S,4R,5R)-1,6,7,8-tetrachlorotricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1R,2S,4R,5R)-1,6,7,8-tetrachlorotricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 23270986 |
| Molecular Formula | C8H6Cl4 |
| Molecular Weight | 243.95 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | (1R,2S,4R,5R)-1,6,7,8-tetrachlorotricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)C(Cl)[C@H]1[C@@H]1C[C@@H]12 |
| InChI | InChI=1S/C8H6Cl4/c9-5-4-2-1-3(2)8(12,6(4)10)7(5)11/h2-4,6H,1H2/t2-,3+,4+,6?,8-/m1/s1 |
| InChIKey | JZIUQSAIOXNWAA-VLBLSOTPSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|