C8H5Cl5 — CID 23270991
(1R,2S,4R,5S)-1,5,6,7,8-pentachlorotricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 23270991) has the molecular formula C8H5Cl5 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1R,2S,4R,5S)-1,5,6,7,8-pentachlorotricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1R,2S,4R,5S)-1,5,6,7,8-pentachlorotricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 23270991 |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 275.88 |
| IUPAC Name | (1R,2S,4R,5S)-1,5,6,7,8-pentachlorotricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)C(Cl)[C@@]1(Cl)[C@@H]1C[C@@H]12 |
| InChI | InChI=1S/C8H5Cl5/c9-4-5(10)8(13)3-1-2(3)7(4,12)6(8)11/h2-3,6H,1H2/t2-,3+,6?,7-,8+ |
| InChIKey | TXISATIFUJLEJH-MLOIRETQSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|