C8H4Cl6 — CID 23270998
(1S,2S,4R,5R)-1,5,6,7,8,8-hexachlorotricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 23270998) has the molecular formula C8H4Cl6 and a molecular weight of 312.84 g/mol. Its IUPAC name is (1S,2S,4R,5R)-1,5,6,7,8,8-hexachlorotricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1S,2S,4R,5R)-1,5,6,7,8,8-hexachlorotricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 23270998 |
| Molecular Formula | C8H4Cl6 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 309.84 |
| IUPAC Name | (1S,2S,4R,5R)-1,5,6,7,8,8-hexachlorotricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)[C@@H]3C[C@@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C8H4Cl6/c9-4-5(10)7(12)3-1-2(3)6(4,11)8(7,13)14/h2-3H,1H2/t2-,3+,6-,7+ |
| InChIKey | BGHVPJJIGIHVJV-GPOSKSIVSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|